C16H22F4N6O3S2 — CID 140884729
1-(cyanomethyl)-3-[5-(difluoromethyl)-1,3,4-thiadiazolidin-2-yl]-6-fluoro-N-[1-(fluoromethyl)cyclopropyl]-2-oxo-3a,4,5,6,7,7a-hexahydrobenzimidazole-5-sulfonamide (PubChem CID 140884729) has the molecular formula C16H22F4N6O3S2 and a molecular weight of 486.52 g/mol. Its IUPAC name is 1-(cyanomethyl)-3-[5-(difluoromethyl)-1,3,4-thiadiazolidin-2-yl]-6-fluoro-N-[1-(fluoromethyl)cyclopropyl]-2-oxo-3a,4,5,6,7,7a-hexahydrobenzimidazole-5-sulfonamide.
| Compound Name | 1-(cyanomethyl)-3-[5-(difluoromethyl)-1,3,4-thiadiazolidin-2-yl]-6-fluoro-N-[1-(fluoromethyl)cyclopropyl]-2-oxo-3a,4,5,6,7,7a-hexahydrobenzimidazole-5-sulfonamide |
|---|---|
| PubChem CID | 140884729 |
| Molecular Formula | C16H22F4N6O3S2 |
| Molecular Weight | 486.52 g/mol |
| Exact Mass | 486.11 |
| IUPAC Name | 1-(cyanomethyl)-3-[5-(difluoromethyl)-1,3,4-thiadiazolidin-2-yl]-6-fluoro-N-[1-(fluoromethyl)cyclopropyl]-2-oxo-3a,4,5,6,7,7a-hexahydrobenzimidazole-5-sulfonamide |
| SMILES | N#CCN1C(=O)N(C2NNC(C(F)F)S2)C2CC(S(=O)(=O)NC3(CF)CC3)C(F)CC21 |
| InChI | InChI=1S/C16H22F4N6O3S2/c17-7-16(1-2-16)24-31(28,29)11-6-10-9(5-8(11)18)25(4-3-21)15(27)26(10)14-23-22-13(30-14)12(19)20/h8-14,22-24H,1-2,4-7H2 |
| InChIKey | IWNDSGOGVWHBRP-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 117.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.52 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|