C16H28FN5O4S — CID 140884771
1-(2-fluoroethyl)-N-(1-methylcyclopropyl)-3-(5-methyl-1,3,4-oxadiazolidin-2-yl)-2-oxo-3a,4,5,6,7,7a-hexahydrobenzimidazole-5-sulfonamide (PubChem CID 140884771) has the molecular formula C16H28FN5O4S and a molecular weight of 405.50 g/mol. Its IUPAC name is 1-(2-fluoroethyl)-N-(1-methylcyclopropyl)-3-(5-methyl-1,3,4-oxadiazolidin-2-yl)-2-oxo-3a,4,5,6,7,7a-hexahydrobenzimidazole-5-sulfonamide.
| Compound Name | 1-(2-fluoroethyl)-N-(1-methylcyclopropyl)-3-(5-methyl-1,3,4-oxadiazolidin-2-yl)-2-oxo-3a,4,5,6,7,7a-hexahydrobenzimidazole-5-sulfonamide |
|---|---|
| PubChem CID | 140884771 |
| Molecular Formula | C16H28FN5O4S |
| Molecular Weight | 405.50 g/mol |
| Exact Mass | 405.18 |
| IUPAC Name | 1-(2-fluoroethyl)-N-(1-methylcyclopropyl)-3-(5-methyl-1,3,4-oxadiazolidin-2-yl)-2-oxo-3a,4,5,6,7,7a-hexahydrobenzimidazole-5-sulfonamide |
| SMILES | CC1NNC(N2C(=O)N(CCF)C3CCC(S(=O)(=O)NC4(C)CC4)CC32)O1 |
| InChI | InChI=1S/C16H28FN5O4S/c1-10-18-19-14(26-10)22-13-9-11(27(24,25)20-16(2)5-6-16)3-4-12(13)21(8-7-17)15(22)23/h10-14,18-20H,3-9H2,1-2H3 |
| InChIKey | GKOYVKWZDZBSMC-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 103.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.50 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |