C17H23F4N5O3S2 — CID 140884797
3-[5-(difluoromethyl)-1,3,4-thiadiazolidin-2-yl]-6-fluoro-N-[1-(fluoromethyl)cyclopropyl]-2-oxo-1-prop-2-ynyl-3a,4,5,6,7,7a-hexahydrobenzimidazole-5-sulfonamide (PubChem CID 140884797) has the molecular formula C17H23F4N5O3S2 and a molecular weight of 485.53 g/mol. Its IUPAC name is 3-[5-(difluoromethyl)-1,3,4-thiadiazolidin-2-yl]-6-fluoro-N-[1-(fluoromethyl)cyclopropyl]-2-oxo-1-prop-2-ynyl-3a,4,5,6,7,7a-hexahydrobenzimidazole-5-sulfonamide.
| Compound Name | 3-[5-(difluoromethyl)-1,3,4-thiadiazolidin-2-yl]-6-fluoro-N-[1-(fluoromethyl)cyclopropyl]-2-oxo-1-prop-2-ynyl-3a,4,5,6,7,7a-hexahydrobenzimidazole-5-sulfonamide |
|---|---|
| PubChem CID | 140884797 |
| Molecular Formula | C17H23F4N5O3S2 |
| Molecular Weight | 485.53 g/mol |
| Exact Mass | 485.12 |
| IUPAC Name | 3-[5-(difluoromethyl)-1,3,4-thiadiazolidin-2-yl]-6-fluoro-N-[1-(fluoromethyl)cyclopropyl]-2-oxo-1-prop-2-ynyl-3a,4,5,6,7,7a-hexahydrobenzimidazole-5-sulfonamide |
| SMILES | C#CCN1C(=O)N(C2NNC(C(F)F)S2)C2CC(S(=O)(=O)NC3(CF)CC3)C(F)CC21 |
| InChI | InChI=1S/C17H23F4N5O3S2/c1-2-5-25-10-6-9(19)12(31(28,29)24-17(8-18)3-4-17)7-11(10)26(16(25)27)15-23-22-14(30-15)13(20)21/h1,9-15,22-24H,3-8H2 |
| InChIKey | TWICNSOBTPPSLT-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 93.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.53 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|