C16H28FN5O4S2 — CID 140884812
N-[1-(fluoromethyl)cyclopropyl]-1-(2-methoxyethyl)-2-oxo-3-(1,2,4-thiadiazolidin-5-yl)-3a,4,5,6,7,7a-hexahydrobenzimidazole-5-sulfonamide (PubChem CID 140884812) has the molecular formula C16H28FN5O4S2 and a molecular weight of 437.56 g/mol. Its IUPAC name is N-[1-(fluoromethyl)cyclopropyl]-1-(2-methoxyethyl)-2-oxo-3-(1,2,4-thiadiazolidin-5-yl)-3a,4,5,6,7,7a-hexahydrobenzimidazole-5-sulfonamide.
| Compound Name | N-[1-(fluoromethyl)cyclopropyl]-1-(2-methoxyethyl)-2-oxo-3-(1,2,4-thiadiazolidin-5-yl)-3a,4,5,6,7,7a-hexahydrobenzimidazole-5-sulfonamide |
|---|---|
| PubChem CID | 140884812 |
| Molecular Formula | C16H28FN5O4S2 |
| Molecular Weight | 437.56 g/mol |
| Exact Mass | 437.16 |
| IUPAC Name | N-[1-(fluoromethyl)cyclopropyl]-1-(2-methoxyethyl)-2-oxo-3-(1,2,4-thiadiazolidin-5-yl)-3a,4,5,6,7,7a-hexahydrobenzimidazole-5-sulfonamide |
| SMILES | COCCN1C(=O)N(C2NCNS2)C2CC(S(=O)(=O)NC3(CF)CC3)CCC21 |
| InChI | InChI=1S/C16H28FN5O4S2/c1-26-7-6-21-12-3-2-11(28(24,25)20-16(9-17)4-5-16)8-13(12)22(15(21)23)14-18-10-19-27-14/h11-14,18-20H,2-10H2,1H3 |
| InChIKey | RIZFVLAQIMQHDP-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 103.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.56 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|