C15H26FN5O3S2 — CID 140884814
6-fluoro-1-methyl-N-(1-methylcyclopropyl)-3-(5-methyl-1,3,4-thiadiazolidin-2-yl)-2-oxo-3a,4,5,6,7,7a-hexahydrobenzimidazole-5-sulfonamide (PubChem CID 140884814) has the molecular formula C15H26FN5O3S2 and a molecular weight of 407.54 g/mol. Its IUPAC name is 6-fluoro-1-methyl-N-(1-methylcyclopropyl)-3-(5-methyl-1,3,4-thiadiazolidin-2-yl)-2-oxo-3a,4,5,6,7,7a-hexahydrobenzimidazole-5-sulfonamide.
| Compound Name | 6-fluoro-1-methyl-N-(1-methylcyclopropyl)-3-(5-methyl-1,3,4-thiadiazolidin-2-yl)-2-oxo-3a,4,5,6,7,7a-hexahydrobenzimidazole-5-sulfonamide |
|---|---|
| PubChem CID | 140884814 |
| Molecular Formula | C15H26FN5O3S2 |
| Molecular Weight | 407.54 g/mol |
| Exact Mass | 407.15 |
| IUPAC Name | 6-fluoro-1-methyl-N-(1-methylcyclopropyl)-3-(5-methyl-1,3,4-thiadiazolidin-2-yl)-2-oxo-3a,4,5,6,7,7a-hexahydrobenzimidazole-5-sulfonamide |
| SMILES | CC1NNC(N2C(=O)N(C)C3CC(F)C(S(=O)(=O)NC4(C)CC4)CC32)S1 |
| InChI | InChI=1S/C15H26FN5O3S2/c1-8-17-18-13(25-8)21-11-7-12(26(23,24)19-15(2)4-5-15)9(16)6-10(11)20(3)14(21)22/h8-13,17-19H,4-7H2,1-3H3 |
| InChIKey | WVDDEGCJAMMMQF-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 93.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.54 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |