C25H48O4 — CID 140885315
[2,2-dimethyl-3-(2-propylheptanoyloxy)propyl] 2-propylheptanoate (PubChem CID 140885315) has the molecular formula C25H48O4 and a molecular weight of 412.66 g/mol. Its IUPAC name is [2,2-dimethyl-3-(2-propylheptanoyloxy)propyl] 2-propylheptanoate.
| Compound Name | [2,2-dimethyl-3-(2-propylheptanoyloxy)propyl] 2-propylheptanoate |
|---|---|
| PubChem CID | 140885315 |
| Molecular Formula | C25H48O4 |
| Molecular Weight | 412.66 g/mol |
| Exact Mass | 412.36 |
| IUPAC Name | [2,2-dimethyl-3-(2-propylheptanoyloxy)propyl] 2-propylheptanoate |
| SMILES | CCCCCC(CCC)C(=O)OCC(C)(C)COC(=O)C(CCC)CCCCC |
| InChI | InChI=1S/C25H48O4/c1-7-11-13-17-21(15-9-3)23(26)28-19-25(5,6)20-29-24(27)22(16-10-4)18-14-12-8-2/h21-22H,7-20H2,1-6H3 |
| InChIKey | CKOZVUYMOXYKHI-UHFFFAOYSA-N |
| XLogP | 7.09 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.66 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|