C9H5F3N4 — CID 140885632
5-(trifluoromethyl)-2,12-diaza-6-azonia-7-azanidatricyclo[6.4.0.02,6]dodeca-1(8),3,5,9,11-pentaene (PubChem CID 140885632) has the molecular formula C9H5F3N4 and a molecular weight of 226.16 g/mol. Its IUPAC name is 5-(trifluoromethyl)-2,12-diaza-6-azonia-7-azanidatricyclo[6.4.0.02,6]dodeca-1(8),3,5,9,11-pentaene.
| Compound Name | 5-(trifluoromethyl)-2,12-diaza-6-azonia-7-azanidatricyclo[6.4.0.02,6]dodeca-1(8),3,5,9,11-pentaene |
|---|---|
| PubChem CID | 140885632 |
| Molecular Formula | C9H5F3N4 |
| Molecular Weight | 226.16 g/mol |
| Exact Mass | 226.05 |
| IUPAC Name | 5-(trifluoromethyl)-2,12-diaza-6-azonia-7-azanidatricyclo[6.4.0.02,6]dodeca-1(8),3,5,9,11-pentaene |
| SMILES | FC(F)(F)c1ccn2c3ncccc3[n-][n+]12 |
| InChI | InChI=1S/C9H5F3N4/c10-9(11,12)7-3-5-15-8-6(14-16(7)15)2-1-4-13-8/h1-5H |
| InChIKey | UKFWSTRMJAAYLI-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 35.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.16 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|