About CID 140886117
CID 140886117 (PubChem CID 140886117) has the molecular formula C43H26CoGeN5OS
and a molecular weight of 792.33 g/mol.
Molecular Properties
| Compound Name | CID 140886117 |
| PubChem CID | 140886117 |
| Molecular Formula | C43H26CoGeN5OS |
| Molecular Weight | 792.33 g/mol |
| Exact Mass | 793.04 |
| IUPAC Name | — |
| SMILES | [Co].c1ccc([Ge](c2ccccc2)n2c3ccccc3c3sc4cc5c6ccccc6n(-c6coc7ccc(-c8ccccn8)nc67)c5nc4c32)cc1 |
| InChI | InChI=1S/C43H26GeN5OS.Co/c1-3-13-27(14-4-1)44(28-15-5-2-6-16-28)49-35-21-10-8-18-30(35)42-41(49)40-38(51-42)25-31-29-17-7-9-20-34(29)48(43(31)47-40)36-26-50-37-23-22-33(46-39(36)37)32-19-11-12-24-45-32;/h1-26H; |
| InChIKey | XKXQSUSNETXFIT-UHFFFAOYSA-N |
| XLogP | 9.36 |
| TPSA | 61.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 52 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 792.33 |
| LogP ≤ 5 | 9.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze CID 140886117 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 140886117?
The IUPAC name of CID 140886117 (CID 140886117) is not available.
What is the SMILES notation for CID 140886117?
The canonical SMILES for CID 140886117 is [Co].c1ccc([Ge](c2ccccc2)n2c3ccccc3c3sc4cc5c6ccccc6n(-c6coc7ccc(-c8ccccn8)nc67)c5nc4c32)cc1.
What is the InChIKey of CID 140886117?
The InChIKey is XKXQSUSNETXFIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C43H26GeN5OS.Co/c1-3-13-27(14-4-1)44(28-15-5-2-6-16-28)49-35-21-10-8-18-30(35)42-41(49)40-38(51-42)25-31-29-17-7-9-20-34(29)48(43(31)47-40)36-26-50-37-23-22-33(46-39(36)37)32-19-11-12-24-45-32;/h1-26H;.
What are the key properties of CID 140886117?
CID 140886117 has a molecular weight of 792.33 g/mol, XLogP of 9.36, 5 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for CID 140886117 is sourced from PubChem (CID 140886117), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).