C19H29F2NO4Si — CID 140886495
2-trimethylsilylethyl N-[(2S,3R,5S)-2-(3,4-difluorophenyl)-5-(2-methoxyethyl)oxolan-3-yl]carbamate (PubChem CID 140886495) has the molecular formula C19H29F2NO4Si and a molecular weight of 401.53 g/mol. Its IUPAC name is 2-trimethylsilylethyl N-[(2S,3R,5S)-2-(3,4-difluorophenyl)-5-(2-methoxyethyl)oxolan-3-yl]carbamate.
| Compound Name | 2-trimethylsilylethyl N-[(2S,3R,5S)-2-(3,4-difluorophenyl)-5-(2-methoxyethyl)oxolan-3-yl]carbamate |
|---|---|
| PubChem CID | 140886495 |
| Molecular Formula | C19H29F2NO4Si |
| Molecular Weight | 401.53 g/mol |
| Exact Mass | 401.18 |
| IUPAC Name | 2-trimethylsilylethyl N-[(2S,3R,5S)-2-(3,4-difluorophenyl)-5-(2-methoxyethyl)oxolan-3-yl]carbamate |
| SMILES | COCC[C@@H]1C[C@@H](NC(=O)OCC[Si](C)(C)C)[C@H](c2ccc(F)c(F)c2)O1 |
| InChI | InChI=1S/C19H29F2NO4Si/c1-24-8-7-14-12-17(22-19(23)25-9-10-27(2,3)4)18(26-14)13-5-6-15(20)16(21)11-13/h5-6,11,14,17-18H,7-10,12H2,1-4H3,(H,22,23)/t14-,17-,18+/m1/s1 |
| InChIKey | PWUQSFOPCQMVLI-OLMNPRSZSA-N |
| XLogP | 4.26 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.53 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|