C25H42Si — CID 140886613
2,3,3a,7a-tetrahydro-1H-inden-1-yl-(5-tert-butyl-2-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl)-dimethylsilane (PubChem CID 140886613) has the molecular formula C25H42Si and a molecular weight of 370.70 g/mol. Its IUPAC name is 2,3,3a,7a-tetrahydro-1H-inden-1-yl-(5-tert-butyl-2-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl)-dimethylsilane.
| Compound Name | 2,3,3a,7a-tetrahydro-1H-inden-1-yl-(5-tert-butyl-2-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl)-dimethylsilane |
|---|---|
| PubChem CID | 140886613 |
| Molecular Formula | C25H42Si |
| Molecular Weight | 370.70 g/mol |
| Exact Mass | 370.31 |
| IUPAC Name | 2,3,3a,7a-tetrahydro-1H-inden-1-yl-(5-tert-butyl-2-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl)-dimethylsilane |
| SMILES | CC1CC2CC(C(C)(C)C)CCC2C1[Si](C)(C)C1CCC2C=CC=CC21 |
| InChI | InChI=1S/C25H42Si/c1-17-15-19-16-20(25(2,3)4)12-13-22(19)24(17)26(5,6)23-14-11-18-9-7-8-10-21(18)23/h7-10,17-24H,11-16H2,1-6H3 |
| InChIKey | OTAQZWDNPWHREW-UHFFFAOYSA-N |
| XLogP | 7.71 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.70 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|