About 2-hydroxy-N'-(3,3,3-trifluoropropyl)propanediamide
2-hydroxy-N'-(3,3,3-trifluoropropyl)propanediamide (PubChem CID 140886991) has the molecular formula C6H9F3N2O3
and a molecular weight of 214.14 g/mol. Its IUPAC name is 2-hydroxy-N'-(3,3,3-trifluoropropyl)propanediamide.
Molecular Properties
| Compound Name | 2-hydroxy-N'-(3,3,3-trifluoropropyl)propanediamide |
| PubChem CID | 140886991 |
| Molecular Formula | C6H9F3N2O3 |
| Molecular Weight | 214.14 g/mol |
| Exact Mass | 214.06 |
| IUPAC Name | 2-hydroxy-N'-(3,3,3-trifluoropropyl)propanediamide |
| SMILES | NC(=O)C(O)C(=O)NCCC(F)(F)F |
| InChI | InChI=1S/C6H9F3N2O3/c7-6(8,9)1-2-11-5(14)3(12)4(10)13/h3,12H,1-2H2,(H2,10,13)(H,11,14) |
| InChIKey | IQCARIXWBQNGSB-UHFFFAOYSA-N |
| XLogP | -1.10 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.14 |
| LogP ≤ 5 | -1.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 2-hydroxy-N'-(3,3,3-trifluoropropyl)propanediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxy-N'-(3,3,3-trifluoropropyl)propanediamide?
The IUPAC name of 2-hydroxy-N'-(3,3,3-trifluoropropyl)propanediamide (CID 140886991) is 2-hydroxy-N'-(3,3,3-trifluoropropyl)propanediamide.
What is the SMILES notation for 2-hydroxy-N'-(3,3,3-trifluoropropyl)propanediamide?
The canonical SMILES for 2-hydroxy-N'-(3,3,3-trifluoropropyl)propanediamide is NC(=O)C(O)C(=O)NCCC(F)(F)F.
What is the InChIKey of 2-hydroxy-N'-(3,3,3-trifluoropropyl)propanediamide?
The InChIKey is IQCARIXWBQNGSB-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9F3N2O3/c7-6(8,9)1-2-11-5(14)3(12)4(10)13/h3,12H,1-2H2,(H2,10,13)(H,11,14).
What are the key properties of 2-hydroxy-N'-(3,3,3-trifluoropropyl)propanediamide?
2-hydroxy-N'-(3,3,3-trifluoropropyl)propanediamide has a molecular weight of 214.14 g/mol, XLogP of -1.10, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxy-N'-(3,3,3-trifluoropropyl)propanediamide is sourced from PubChem (CID 140886991), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).