C27H35BBr2N2O5 — CID 140887110
N'-tert-butyl-N'-[3-(dibromomethyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoyl]-3-methoxy-2-methylbenzohydrazide (PubChem CID 140887110) has the molecular formula C27H35BBr2N2O5 and a molecular weight of 638.21 g/mol. Its IUPAC name is N'-tert-butyl-N'-[3-(dibromomethyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoyl]-3-methoxy-2-methylbenzohydrazide.
| Compound Name | N'-tert-butyl-N'-[3-(dibromomethyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoyl]-3-methoxy-2-methylbenzohydrazide |
|---|---|
| PubChem CID | 140887110 |
| Molecular Formula | C27H35BBr2N2O5 |
| Molecular Weight | 638.21 g/mol |
| Exact Mass | 636.10 |
| IUPAC Name | N'-tert-butyl-N'-[3-(dibromomethyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoyl]-3-methoxy-2-methylbenzohydrazide |
| SMILES | COc1cccc(C(=O)NN(C(=O)c2ccc(B3OC(C)(C)C(C)(C)O3)c(C(Br)Br)c2)C(C)(C)C)c1C |
| InChI | InChI=1S/C27H35BBr2N2O5/c1-16-18(11-10-12-21(16)35-9)23(33)31-32(25(2,3)4)24(34)17-13-14-20(19(15-17)22(29)30)28-36-26(5,6)27(7,8)37-28/h10-15,22H,1-9H3,(H,31,33) |
| InChIKey | UTDYOPWZGLZDSV-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.21 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|