C24H34O7Si — CID 140887303
(1S,2S,4S,5S,7S,8R,9R,11S,13S)-8-[2-[hydroxy(dimethyl)silyl]ethoxy]-1-methyl-7-propan-2-yl-3,6,10,16-tetraoxaheptacyclo[11.7.0.02,4.02,9.05,7.09,11.014,18]icos-14(18)-en-17-one (PubChem CID 140887303) has the molecular formula C24H34O7Si and a molecular weight of 462.62 g/mol. Its IUPAC name is (1S,2S,4S,5S,7S,8R,9R,11S,13S)-8-[2-[hydroxy(dimethyl)silyl]ethoxy]-1-methyl-7-propan-2-yl-3,6,10,16-tetraoxaheptacyclo[11.7.0.02,4.02,9.05,7.09,11.014,18]icos-14(18)-en-17-one.
| Compound Name | (1S,2S,4S,5S,7S,8R,9R,11S,13S)-8-[2-[hydroxy(dimethyl)silyl]ethoxy]-1-methyl-7-propan-2-yl-3,6,10,16-tetraoxaheptacyclo[11.7.0.02,4.02,9.05,7.09,11.014,18]icos-14(18)-en-17-one |
|---|---|
| PubChem CID | 140887303 |
| Molecular Formula | C24H34O7Si |
| Molecular Weight | 462.62 g/mol |
| Exact Mass | 462.21 |
| IUPAC Name | (1S,2S,4S,5S,7S,8R,9R,11S,13S)-8-[2-[hydroxy(dimethyl)silyl]ethoxy]-1-methyl-7-propan-2-yl-3,6,10,16-tetraoxaheptacyclo[11.7.0.02,4.02,9.05,7.09,11.014,18]icos-14(18)-en-17-one |
| SMILES | CC(C)[C@]12O[C@H]1[C@@H]1O[C@]13[C@]1(O[C@H]1C[C@H]1C4=C(CC[C@@]13C)C(=O)OC4)[C@@H]2OCC[Si](C)(C)O |
| InChI | InChI=1S/C24H34O7Si/c1-12(2)22-17(30-22)18-24(31-18)21(3)7-6-13-14(11-28-19(13)25)15(21)10-16-23(24,29-16)20(22)27-8-9-32(4,5)26/h12,15-18,20,26H,6-11H2,1-5H3/t15-,16-,17-,18-,20+,21-,22-,23+,24+/m0/s1 |
| InChIKey | CEIFBGGZKMANEZ-ITRZRQIZSA-N |
| XLogP | 2.32 |
| TPSA | 93.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.62 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|