About [1-(4-cyano-1,3-thiazol-2-yl)ethylideneamino] benzenesulfonate
[1-(4-cyano-1,3-thiazol-2-yl)ethylideneamino] benzenesulfonate (PubChem CID 140887408) has the molecular formula C12H9N3O3S2
and a molecular weight of 307.36 g/mol. Its IUPAC name is [1-(4-cyano-1,3-thiazol-2-yl)ethylideneamino] benzenesulfonate.
Molecular Properties
| Compound Name | [1-(4-cyano-1,3-thiazol-2-yl)ethylideneamino] benzenesulfonate |
| PubChem CID | 140887408 |
| Molecular Formula | C12H9N3O3S2 |
| Molecular Weight | 307.36 g/mol |
| Exact Mass | 307.01 |
| IUPAC Name | [1-(4-cyano-1,3-thiazol-2-yl)ethylideneamino] benzenesulfonate |
| SMILES | CC(=NOS(=O)(=O)c1ccccc1)c1nc(C#N)cs1 |
| InChI | InChI=1S/C12H9N3O3S2/c1-9(12-14-10(7-13)8-19-12)15-18-20(16,17)11-5-3-2-4-6-11/h2-6,8H,1H3 |
| InChIKey | DVTYBUMAKLTSKH-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 92.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.36 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [1-(4-cyano-1,3-thiazol-2-yl)ethylideneamino] benzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(4-cyano-1,3-thiazol-2-yl)ethylideneamino] benzenesulfonate?
The IUPAC name of [1-(4-cyano-1,3-thiazol-2-yl)ethylideneamino] benzenesulfonate (CID 140887408) is [1-(4-cyano-1,3-thiazol-2-yl)ethylideneamino] benzenesulfonate.
What is the SMILES notation for [1-(4-cyano-1,3-thiazol-2-yl)ethylideneamino] benzenesulfonate?
The canonical SMILES for [1-(4-cyano-1,3-thiazol-2-yl)ethylideneamino] benzenesulfonate is CC(=NOS(=O)(=O)c1ccccc1)c1nc(C#N)cs1.
What is the InChIKey of [1-(4-cyano-1,3-thiazol-2-yl)ethylideneamino] benzenesulfonate?
The InChIKey is DVTYBUMAKLTSKH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9N3O3S2/c1-9(12-14-10(7-13)8-19-12)15-18-20(16,17)11-5-3-2-4-6-11/h2-6,8H,1H3.
What are the key properties of [1-(4-cyano-1,3-thiazol-2-yl)ethylideneamino] benzenesulfonate?
[1-(4-cyano-1,3-thiazol-2-yl)ethylideneamino] benzenesulfonate has a molecular weight of 307.36 g/mol, XLogP of 2.14, 4 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(4-cyano-1,3-thiazol-2-yl)ethylideneamino] benzenesulfonate is sourced from PubChem (CID 140887408), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).