C39H48B3N3O6 — CID 140888105
2,4,6-tris[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,3,5-triazine (PubChem CID 140888105) has the molecular formula C39H48B3N3O6 and a molecular weight of 687.26 g/mol. Its IUPAC name is 2,4,6-tris[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,3,5-triazine.
| Compound Name | 2,4,6-tris[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,3,5-triazine |
|---|---|
| PubChem CID | 140888105 |
| Molecular Formula | C39H48B3N3O6 |
| Molecular Weight | 687.26 g/mol |
| Exact Mass | 687.38 |
| IUPAC Name | 2,4,6-tris[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,3,5-triazine |
| SMILES | CC1(C)OB(c2cccc(-c3nc(-c4cccc(B5OC(C)(C)C(C)(C)O5)c4)nc(-c4cccc(B5OC(C)(C)C(C)(C)O5)c4)n3)c2)OC1(C)C |
| InChI | InChI=1S/C39H48B3N3O6/c1-34(2)35(3,4)47-40(46-34)28-19-13-16-25(22-28)31-43-32(26-17-14-20-29(23-26)41-48-36(5,6)37(7,8)49-41)45-33(44-31)27-18-15-21-30(24-27)42-50-38(9,10)39(11,12)51-42/h13-24H,1-12H3 |
| InChIKey | OQWRWZQYRAKOQX-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 94.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 687.26 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|