C36H26ClF3N8O — CID 140888167
4-chloro-3-methyl-N-[4-(trifluoromethyl)phenyl]-1-[(1-trityltetrazol-5-yl)methyl]pyrazolo[3,4-b]pyridine-5-carboxamide (PubChem CID 140888167) has the molecular formula C36H26ClF3N8O and a molecular weight of 679.11 g/mol. Its IUPAC name is 4-chloro-3-methyl-N-[4-(trifluoromethyl)phenyl]-1-[(1-trityltetrazol-5-yl)methyl]pyrazolo[3,4-b]pyridine-5-carboxamide.
| Compound Name | 4-chloro-3-methyl-N-[4-(trifluoromethyl)phenyl]-1-[(1-trityltetrazol-5-yl)methyl]pyrazolo[3,4-b]pyridine-5-carboxamide |
|---|---|
| PubChem CID | 140888167 |
| Molecular Formula | C36H26ClF3N8O |
| Molecular Weight | 679.11 g/mol |
| Exact Mass | 678.19 |
| IUPAC Name | 4-chloro-3-methyl-N-[4-(trifluoromethyl)phenyl]-1-[(1-trityltetrazol-5-yl)methyl]pyrazolo[3,4-b]pyridine-5-carboxamide |
| SMILES | Cc1nn(Cc2nnnn2C(c2ccccc2)(c2ccccc2)c2ccccc2)c2ncc(C(=O)Nc3ccc(C(F)(F)F)cc3)c(Cl)c12 |
| InChI | InChI=1S/C36H26ClF3N8O/c1-23-31-32(37)29(34(49)42-28-19-17-27(18-20-28)36(38,39)40)21-41-33(31)47(44-23)22-30-43-45-46-48(30)35(24-11-5-2-6-12-24,25-13-7-3-8-14-25)26-15-9-4-10-16-26/h2-21H,22H2,1H3,(H,42,49) |
| InChIKey | IOZYIKCEBRDPFH-UHFFFAOYSA-N |
| XLogP | 7.54 |
| TPSA | 103.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.11 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|