About acetamide
acetamide (PubChem CID 140888293) has the molecular formula C2H5NO
and a molecular weight of 61.05 g/mol. Its IUPAC name is acetamide.
Molecular Properties
| Compound Name | acetamide |
| PubChem CID | 140888293 |
| Molecular Formula | C2H5NO |
| Molecular Weight | 61.05 g/mol |
| Exact Mass | 61.04 |
| IUPAC Name | acetamide |
| SMILES | [13CH3][13C](N)=O |
| InChI | InChI=1S/C2H5NO/c1-2(3)4/h1H3,(H2,3,4)/i1+1,2+1 |
| InChIKey | DLFVBJFMPXGRIB-ZDOIIHCHSA-N |
| XLogP | -0.51 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 4 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 61.05 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetamide?
The IUPAC name of acetamide (CID 140888293) is acetamide.
What is the SMILES notation for acetamide?
The canonical SMILES for acetamide is [13CH3][13C](N)=O.
What is the InChIKey of acetamide?
The InChIKey is DLFVBJFMPXGRIB-ZDOIIHCHSA-N. The full InChI is InChI=1S/C2H5NO/c1-2(3)4/h1H3,(H2,3,4)/i1+1,2+1.
What are the key properties of acetamide?
acetamide has a molecular weight of 61.05 g/mol, XLogP of -0.51, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for acetamide is sourced from PubChem (CID 140888293), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).