C19H25F3N2O5 — CID 140888433
methyl 5-nitro-2-(2,2,2-trifluoroethoxy)-4-[[(1S,5S)-3,3,5-trimethylcyclohexyl]amino]benzoate (PubChem CID 140888433) has the molecular formula C19H25F3N2O5 and a molecular weight of 418.41 g/mol. Its IUPAC name is methyl 5-nitro-2-(2,2,2-trifluoroethoxy)-4-[[(1S,5S)-3,3,5-trimethylcyclohexyl]amino]benzoate.
| Compound Name | methyl 5-nitro-2-(2,2,2-trifluoroethoxy)-4-[[(1S,5S)-3,3,5-trimethylcyclohexyl]amino]benzoate |
|---|---|
| PubChem CID | 140888433 |
| Molecular Formula | C19H25F3N2O5 |
| Molecular Weight | 418.41 g/mol |
| Exact Mass | 418.17 |
| IUPAC Name | methyl 5-nitro-2-(2,2,2-trifluoroethoxy)-4-[[(1S,5S)-3,3,5-trimethylcyclohexyl]amino]benzoate |
| SMILES | COC(=O)c1cc([N+](=O)[O-])c(N[C@H]2C[C@@H](C)CC(C)(C)C2)cc1OCC(F)(F)F |
| InChI | InChI=1S/C19H25F3N2O5/c1-11-5-12(9-18(2,3)8-11)23-14-7-16(29-10-19(20,21)22)13(17(25)28-4)6-15(14)24(26)27/h6-7,11-12,23H,5,8-10H2,1-4H3/t11-,12+/m1/s1 |
| InChIKey | FJLDLTJUUNKAAH-NEPJUHHUSA-N |
| XLogP | 4.95 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.41 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|