About hydroxy-dimethyl-(2,2,3-trifluorobutyl)silane
hydroxy-dimethyl-(2,2,3-trifluorobutyl)silane (PubChem CID 140888461) has the molecular formula C6H13F3OSi
and a molecular weight of 186.25 g/mol. Its IUPAC name is hydroxy-dimethyl-(2,2,3-trifluorobutyl)silane.
Molecular Properties
| Compound Name | hydroxy-dimethyl-(2,2,3-trifluorobutyl)silane |
| PubChem CID | 140888461 |
| Molecular Formula | C6H13F3OSi |
| Molecular Weight | 186.25 g/mol |
| Exact Mass | 186.07 |
| IUPAC Name | hydroxy-dimethyl-(2,2,3-trifluorobutyl)silane |
| SMILES | CC(F)C(F)(F)C[Si](C)(C)O |
| InChI | InChI=1S/C6H13F3OSi/c1-5(7)6(8,9)4-11(2,3)10/h5,10H,4H2,1-3H3 |
| InChIKey | AUWLRKHPDAGBRL-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.25 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze hydroxy-dimethyl-(2,2,3-trifluorobutyl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydroxy-dimethyl-(2,2,3-trifluorobutyl)silane?
The IUPAC name of hydroxy-dimethyl-(2,2,3-trifluorobutyl)silane (CID 140888461) is hydroxy-dimethyl-(2,2,3-trifluorobutyl)silane.
What is the SMILES notation for hydroxy-dimethyl-(2,2,3-trifluorobutyl)silane?
The canonical SMILES for hydroxy-dimethyl-(2,2,3-trifluorobutyl)silane is CC(F)C(F)(F)C[Si](C)(C)O.
What is the InChIKey of hydroxy-dimethyl-(2,2,3-trifluorobutyl)silane?
The InChIKey is AUWLRKHPDAGBRL-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13F3OSi/c1-5(7)6(8,9)4-11(2,3)10/h5,10H,4H2,1-3H3.
What are the key properties of hydroxy-dimethyl-(2,2,3-trifluorobutyl)silane?
hydroxy-dimethyl-(2,2,3-trifluorobutyl)silane has a molecular weight of 186.25 g/mol, XLogP of 2.18, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for hydroxy-dimethyl-(2,2,3-trifluorobutyl)silane is sourced from PubChem (CID 140888461), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).