C46H82N10 — CID 140888711
5,12-bis[3,5-di(piperazin-2-yl)cyclohexyl]-1,2,3,4,4a,5a,6,7,7a,7b,8,9,10,11,11a,12a,12b,12c-octadecahydroindolo[3,2-c]carbazole (PubChem CID 140888711) has the molecular formula C46H82N10 and a molecular weight of 775.23 g/mol. Its IUPAC name is 5,12-bis[3,5-di(piperazin-2-yl)cyclohexyl]-1,2,3,4,4a,5a,6,7,7a,7b,8,9,10,11,11a,12a,12b,12c-octadecahydroindolo[3,2-c]carbazole.
| Compound Name | 5,12-bis[3,5-di(piperazin-2-yl)cyclohexyl]-1,2,3,4,4a,5a,6,7,7a,7b,8,9,10,11,11a,12a,12b,12c-octadecahydroindolo[3,2-c]carbazole |
|---|---|
| PubChem CID | 140888711 |
| Molecular Formula | C46H82N10 |
| Molecular Weight | 775.23 g/mol |
| Exact Mass | 774.67 |
| IUPAC Name | 5,12-bis[3,5-di(piperazin-2-yl)cyclohexyl]-1,2,3,4,4a,5a,6,7,7a,7b,8,9,10,11,11a,12a,12b,12c-octadecahydroindolo[3,2-c]carbazole |
| SMILES | C1CCC2C(C1)C1C(CCC3C4CCCCC4N(C4CC(C5CNCCN5)CC(C5CNCCN5)C4)C31)N2C1CC(C2CNCCN2)CC(C2CNCCN2)C1 |
| InChI | InChI=1S/C46H82N10/c1-3-7-42-35(5-1)36-9-10-44-45(46(36)56(42)34-23-31(40-27-49-13-17-53-40)20-32(24-34)41-28-50-14-18-54-41)37-6-2-4-8-43(37)55(44)33-21-29(38-25-47-11-15-51-38)19-30(22-33)39-26-48-12-16-52-39/h29-54H,1-28H2 |
| InChIKey | UQNSRIQRUBJYLX-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 102.72 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 775.23 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 10 |