C52H84F6N6 — CID 140888825
9,14-bis[2-cyclohexyl-6-[4-(trifluoromethyl)cyclohexyl]-1,3-diazinan-4-yl]-9,14-diazapentacyclo[11.7.0.02,10.03,8.015,20]icosane (PubChem CID 140888825) has the molecular formula C52H84F6N6 and a molecular weight of 907.27 g/mol. Its IUPAC name is 9,14-bis[2-cyclohexyl-6-[4-(trifluoromethyl)cyclohexyl]-1,3-diazinan-4-yl]-9,14-diazapentacyclo[11.7.0.02,10.03,8.015,20]icosane.
| Compound Name | 9,14-bis[2-cyclohexyl-6-[4-(trifluoromethyl)cyclohexyl]-1,3-diazinan-4-yl]-9,14-diazapentacyclo[11.7.0.02,10.03,8.015,20]icosane |
|---|---|
| PubChem CID | 140888825 |
| Molecular Formula | C52H84F6N6 |
| Molecular Weight | 907.27 g/mol |
| Exact Mass | 906.67 |
| IUPAC Name | 9,14-bis[2-cyclohexyl-6-[4-(trifluoromethyl)cyclohexyl]-1,3-diazinan-4-yl]-9,14-diazapentacyclo[11.7.0.02,10.03,8.015,20]icosane |
| SMILES | FC(F)(F)C1CCC(C2CC(N3C4CCCCC4C4C5C6CCCCC6N(C6CC(C7CCC(C(F)(F)F)CC7)NC(C7CCCCC7)N6)C5CCC43)NC(C3CCCCC3)N2)CC1 |
| InChI | InChI=1S/C52H84F6N6/c53-51(54,55)35-23-19-31(20-24-35)39-29-45(61-49(59-39)33-11-3-1-4-12-33)63-41-17-9-7-15-37(41)47-43(63)27-28-44-48(47)38-16-8-10-18-42(38)64(44)46-30-40(32-21-25-36(26-22-32)52(56,57)58)60-50(62-46)34-13-5-2-6-14-34/h31-50,59-62H,1-30H2 |
| InChIKey | KEFZVJHWFRHKRC-UHFFFAOYSA-N |
| XLogP | 11.60 |
| TPSA | 54.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 907.27 |
| LogP ≤ 5 | 11.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |