C29H17N5 — CID 140889097
4-[4-(4-isocyanophenyl)-6-(4-phenylphenyl)-1,3,5-triazin-2-yl]benzonitrile (PubChem CID 140889097) has the molecular formula C29H17N5 and a molecular weight of 435.49 g/mol. Its IUPAC name is 4-[4-(4-isocyanophenyl)-6-(4-phenylphenyl)-1,3,5-triazin-2-yl]benzonitrile.
| Compound Name | 4-[4-(4-isocyanophenyl)-6-(4-phenylphenyl)-1,3,5-triazin-2-yl]benzonitrile |
|---|---|
| PubChem CID | 140889097 |
| Molecular Formula | C29H17N5 |
| Molecular Weight | 435.49 g/mol |
| Exact Mass | 435.15 |
| IUPAC Name | 4-[4-(4-isocyanophenyl)-6-(4-phenylphenyl)-1,3,5-triazin-2-yl]benzonitrile |
| SMILES | [C-]#[N+]c1ccc(-c2nc(-c3ccc(C#N)cc3)nc(-c3ccc(-c4ccccc4)cc3)n2)cc1 |
| InChI | InChI=1S/C29H17N5/c1-31-26-17-15-25(16-18-26)29-33-27(23-9-7-20(19-30)8-10-23)32-28(34-29)24-13-11-22(12-14-24)21-5-3-2-4-6-21/h2-18H |
| InChIKey | GTLCPFMRTHNVNB-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 66.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.49 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|