C31H26BNO2S — CID 140889232
2-[4-(8,14-dioxa-1-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2,4,6,9,11,13(21),15,17,19-nonaen-11-yl)phenyl]-4,4,5,5-tetramethyl-1,3-thiazole (PubChem CID 140889232) has the molecular formula C31H26BNO2S and a molecular weight of 487.43 g/mol. Its IUPAC name is 2-[4-(8,14-dioxa-1-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2,4,6,9,11,13(21),15,17,19-nonaen-11-yl)phenyl]-4,4,5,5-tetramethyl-1,3-thiazole.
| Compound Name | 2-[4-(8,14-dioxa-1-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2,4,6,9,11,13(21),15,17,19-nonaen-11-yl)phenyl]-4,4,5,5-tetramethyl-1,3-thiazole |
|---|---|
| PubChem CID | 140889232 |
| Molecular Formula | C31H26BNO2S |
| Molecular Weight | 487.43 g/mol |
| Exact Mass | 487.18 |
| IUPAC Name | 2-[4-(8,14-dioxa-1-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2,4,6,9,11,13(21),15,17,19-nonaen-11-yl)phenyl]-4,4,5,5-tetramethyl-1,3-thiazole |
| SMILES | CC1(C)N=C(c2ccc(-c3cc4c5c(c3)Oc3ccccc3B5c3ccccc3O4)cc2)SC1(C)C |
| InChI | InChI=1S/C31H26BNO2S/c1-30(2)31(3,4)36-29(33-30)20-15-13-19(14-16-20)21-17-26-28-27(18-21)35-25-12-8-6-10-23(25)32(28)22-9-5-7-11-24(22)34-26/h5-18H,1-4H3 |
| InChIKey | ZMWNDQNMBCCLKA-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.43 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|