C25H19NO4 — CID 140889277
(2-oxo-1,2-diphenylethyl) 3-(1H-indol-3-yl)-3-oxopropanoate (PubChem CID 140889277) has the molecular formula C25H19NO4 and a molecular weight of 397.43 g/mol. Its IUPAC name is (2-oxo-1,2-diphenylethyl) 3-(1H-indol-3-yl)-3-oxopropanoate.
| Compound Name | (2-oxo-1,2-diphenylethyl) 3-(1H-indol-3-yl)-3-oxopropanoate |
|---|---|
| PubChem CID | 140889277 |
| Molecular Formula | C25H19NO4 |
| Molecular Weight | 397.43 g/mol |
| Exact Mass | 397.13 |
| IUPAC Name | (2-oxo-1,2-diphenylethyl) 3-(1H-indol-3-yl)-3-oxopropanoate |
| SMILES | O=C(CC(=O)c1c[nH]c2ccccc12)OC(C(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H19NO4/c27-22(20-16-26-21-14-8-7-13-19(20)21)15-23(28)30-25(18-11-5-2-6-12-18)24(29)17-9-3-1-4-10-17/h1-14,16,25-26H,15H2 |
| InChIKey | UGBPUVUDPCPCBZ-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 76.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.43 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|