About CID 140889359
CID 140889359 (PubChem CID 140889359) has the molecular formula C27H35BFN4O6
and a molecular weight of 541.41 g/mol.
Molecular Properties
| Compound Name | CID 140889359 |
| PubChem CID | 140889359 |
| Molecular Formula | C27H35BFN4O6 |
| Molecular Weight | 541.41 g/mol |
| Exact Mass | 541.26 |
| IUPAC Name | — |
| SMILES | CN(C)CCN(C(=O)OC(C)(C)C)c1cc(F)cc(-c2ccnc3c2cc(O[B]O)n3C(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C27H35BFN4O6/c1-26(2,3)37-24(34)32(12-11-31(7)8)19-14-17(13-18(29)15-19)20-9-10-30-23-21(20)16-22(39-28-36)33(23)25(35)38-27(4,5)6/h9-10,13-16,36H,11-12H2,1-8H3 |
| InChIKey | QFQALVYWYDGZTE-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 106.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 541.41 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 140889359 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 140889359?
The IUPAC name of CID 140889359 (CID 140889359) is not available.
What is the SMILES notation for CID 140889359?
The canonical SMILES for CID 140889359 is CN(C)CCN(C(=O)OC(C)(C)C)c1cc(F)cc(-c2ccnc3c2cc(O[B]O)n3C(=O)OC(C)(C)C)c1.
What is the InChIKey of CID 140889359?
The InChIKey is QFQALVYWYDGZTE-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H35BFN4O6/c1-26(2,3)37-24(34)32(12-11-31(7)8)19-14-17(13-18(29)15-19)20-9-10-30-23-21(20)16-22(39-28-36)33(23)25(35)38-27(4,5)6/h9-10,13-16,36H,11-12H2,1-8H3.
What are the key properties of CID 140889359?
CID 140889359 has a molecular weight of 541.41 g/mol, XLogP of 4.83, 7 rotatable bonds, 1 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for CID 140889359 is sourced from PubChem (CID 140889359), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).