About 3-methyl-2-oxido-[1,2]oxazolo[4,5-b]pyridin-2-ium
3-methyl-2-oxido-[1,2]oxazolo[4,5-b]pyridin-2-ium (PubChem CID 14088956) has the molecular formula C7H6N2O2
and a molecular weight of 150.14 g/mol. Its IUPAC name is 3-methyl-2-oxido-[1,2]oxazolo[4,5-b]pyridin-2-ium.
Molecular Properties
| Compound Name | 3-methyl-2-oxido-[1,2]oxazolo[4,5-b]pyridin-2-ium |
| PubChem CID | 14088956 |
| Molecular Formula | C7H6N2O2 |
| Molecular Weight | 150.14 g/mol |
| Exact Mass | 150.04 |
| IUPAC Name | 3-methyl-2-oxido-[1,2]oxazolo[4,5-b]pyridin-2-ium |
| SMILES | Cc1c2ncccc2o[n+]1[O-] |
| InChI | InChI=1S/C7H6N2O2/c1-5-7-6(11-9(5)10)3-2-4-8-7/h2-4H,1H3 |
| InChIKey | COIBMKKAVDQXTQ-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 52.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.14 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'} |
|---|
Analyze 3-methyl-2-oxido-[1,2]oxazolo[4,5-b]pyridin-2-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-2-oxido-[1,2]oxazolo[4,5-b]pyridin-2-ium?
The IUPAC name of 3-methyl-2-oxido-[1,2]oxazolo[4,5-b]pyridin-2-ium (CID 14088956) is 3-methyl-2-oxido-[1,2]oxazolo[4,5-b]pyridin-2-ium.
What is the SMILES notation for 3-methyl-2-oxido-[1,2]oxazolo[4,5-b]pyridin-2-ium?
The canonical SMILES for 3-methyl-2-oxido-[1,2]oxazolo[4,5-b]pyridin-2-ium is Cc1c2ncccc2o[n+]1[O-].
What is the InChIKey of 3-methyl-2-oxido-[1,2]oxazolo[4,5-b]pyridin-2-ium?
The InChIKey is COIBMKKAVDQXTQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6N2O2/c1-5-7-6(11-9(5)10)3-2-4-8-7/h2-4H,1H3.
What are the key properties of 3-methyl-2-oxido-[1,2]oxazolo[4,5-b]pyridin-2-ium?
3-methyl-2-oxido-[1,2]oxazolo[4,5-b]pyridin-2-ium has a molecular weight of 150.14 g/mol, XLogP of 0.77, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-2-oxido-[1,2]oxazolo[4,5-b]pyridin-2-ium is sourced from PubChem (CID 14088956), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).