C20H27F3N4O4 — CID 140890172
[3-(2,2-dimethylpropanoylamino)-5-(trifluoromethyl)-2-pyridinyl]methyl (3aS,6aR)-3a-methoxy-1,2,3,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylate (PubChem CID 140890172) has the molecular formula C20H27F3N4O4 and a molecular weight of 444.45 g/mol. Its IUPAC name is [3-(2,2-dimethylpropanoylamino)-5-(trifluoromethyl)-2-pyridinyl]methyl (3aS,6aR)-3a-methoxy-1,2,3,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylate.
| Compound Name | [3-(2,2-dimethylpropanoylamino)-5-(trifluoromethyl)-2-pyridinyl]methyl (3aS,6aR)-3a-methoxy-1,2,3,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylate |
|---|---|
| PubChem CID | 140890172 |
| Molecular Formula | C20H27F3N4O4 |
| Molecular Weight | 444.45 g/mol |
| Exact Mass | 444.20 |
| IUPAC Name | [3-(2,2-dimethylpropanoylamino)-5-(trifluoromethyl)-2-pyridinyl]methyl (3aS,6aR)-3a-methoxy-1,2,3,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylate |
| SMILES | CO[C@]12CNC[C@@H]1CN(C(=O)OCc1ncc(C(F)(F)F)cc1NC(=O)C(C)(C)C)C2 |
| InChI | InChI=1S/C20H27F3N4O4/c1-18(2,3)16(28)26-14-5-12(20(21,22)23)7-25-15(14)9-31-17(29)27-8-13-6-24-10-19(13,11-27)30-4/h5,7,13,24H,6,8-11H2,1-4H3,(H,26,28)/t13-,19+/m1/s1 |
| InChIKey | QSZKOMJMGYVWJU-YJYMSZOUSA-N |
| XLogP | 2.64 |
| TPSA | 92.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.45 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |