C23H22FN3O5S2 — CID 140890490
12-(4-fluorophenyl)sulfonyl-4-methyl-8-(methylsulfonylmethyl)-4,12,16-triazatetracyclo[8.6.1.02,7.013,17]heptadeca-1(17),2(7),5,8,10-pentaen-3-one (PubChem CID 140890490) has the molecular formula C23H22FN3O5S2 and a molecular weight of 503.58 g/mol. Its IUPAC name is 12-(4-fluorophenyl)sulfonyl-4-methyl-8-(methylsulfonylmethyl)-4,12,16-triazatetracyclo[8.6.1.02,7.013,17]heptadeca-1(17),2(7),5,8,10-pentaen-3-one.
| Compound Name | 12-(4-fluorophenyl)sulfonyl-4-methyl-8-(methylsulfonylmethyl)-4,12,16-triazatetracyclo[8.6.1.02,7.013,17]heptadeca-1(17),2(7),5,8,10-pentaen-3-one |
|---|---|
| PubChem CID | 140890490 |
| Molecular Formula | C23H22FN3O5S2 |
| Molecular Weight | 503.58 g/mol |
| Exact Mass | 503.10 |
| IUPAC Name | 12-(4-fluorophenyl)sulfonyl-4-methyl-8-(methylsulfonylmethyl)-4,12,16-triazatetracyclo[8.6.1.02,7.013,17]heptadeca-1(17),2(7),5,8,10-pentaen-3-one |
| SMILES | Cn1ccc2c(c1=O)C1=C3C(=CN(S(=O)(=O)c4ccc(F)cc4)C3CCN1)C=C2CS(C)(=O)=O |
| InChI | InChI=1S/C23H22FN3O5S2/c1-26-10-8-18-15(13-33(2,29)30)11-14-12-27(34(31,32)17-5-3-16(24)4-6-17)19-7-9-25-22(20(14)19)21(18)23(26)28/h3-6,8,10-12,19,25H,7,9,13H2,1-2H3 |
| InChIKey | SEGIIWROUWWXGI-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 105.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.58 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |