C22H23F6NO4S — CID 140890740
N-[2-(4-ethylsulfonylphenyl)-4-(1,1,1,3,3,3-hexafluoro-2-propan-2-yloxypropan-2-yl)phenyl]acetamide (PubChem CID 140890740) has the molecular formula C22H23F6NO4S and a molecular weight of 511.48 g/mol. Its IUPAC name is N-[2-(4-ethylsulfonylphenyl)-4-(1,1,1,3,3,3-hexafluoro-2-propan-2-yloxypropan-2-yl)phenyl]acetamide.
| Compound Name | N-[2-(4-ethylsulfonylphenyl)-4-(1,1,1,3,3,3-hexafluoro-2-propan-2-yloxypropan-2-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 140890740 |
| Molecular Formula | C22H23F6NO4S |
| Molecular Weight | 511.48 g/mol |
| Exact Mass | 511.13 |
| IUPAC Name | N-[2-(4-ethylsulfonylphenyl)-4-(1,1,1,3,3,3-hexafluoro-2-propan-2-yloxypropan-2-yl)phenyl]acetamide |
| SMILES | CCS(=O)(=O)c1ccc(-c2cc(C(OC(C)C)(C(F)(F)F)C(F)(F)F)ccc2NC(C)=O)cc1 |
| InChI | InChI=1S/C22H23F6NO4S/c1-5-34(31,32)17-9-6-15(7-10-17)18-12-16(8-11-19(18)29-14(4)30)20(21(23,24)25,22(26,27)28)33-13(2)3/h6-13H,5H2,1-4H3,(H,29,30) |
| InChIKey | FCOOCTZPCIULEC-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.48 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |