C23H25F6NO4S — CID 140890744
N-[2-(4-ethylsulfonylphenyl)-4-[1,1,1,3,3,3-hexafluoro-2-(2-methylpropoxy)propan-2-yl]phenyl]acetamide (PubChem CID 140890744) has the molecular formula C23H25F6NO4S and a molecular weight of 525.51 g/mol. Its IUPAC name is N-[2-(4-ethylsulfonylphenyl)-4-[1,1,1,3,3,3-hexafluoro-2-(2-methylpropoxy)propan-2-yl]phenyl]acetamide.
| Compound Name | N-[2-(4-ethylsulfonylphenyl)-4-[1,1,1,3,3,3-hexafluoro-2-(2-methylpropoxy)propan-2-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 140890744 |
| Molecular Formula | C23H25F6NO4S |
| Molecular Weight | 525.51 g/mol |
| Exact Mass | 525.14 |
| IUPAC Name | N-[2-(4-ethylsulfonylphenyl)-4-[1,1,1,3,3,3-hexafluoro-2-(2-methylpropoxy)propan-2-yl]phenyl]acetamide |
| SMILES | CCS(=O)(=O)c1ccc(-c2cc(C(OCC(C)C)(C(F)(F)F)C(F)(F)F)ccc2NC(C)=O)cc1 |
| InChI | InChI=1S/C23H25F6NO4S/c1-5-35(32,33)18-9-6-16(7-10-18)19-12-17(8-11-20(19)30-15(4)31)21(22(24,25)26,23(27,28)29)34-13-14(2)3/h6-12,14H,5,13H2,1-4H3,(H,30,31) |
| InChIKey | UOHFOTDDAANRGU-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.51 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |