C21H21F6NO4S — CID 140890750
N-[2-[4-(2-ethoxy-1,1,1,3,3,3-hexafluoropropan-2-yl)phenyl]-4-ethylsulfonylphenyl]acetamide (PubChem CID 140890750) has the molecular formula C21H21F6NO4S and a molecular weight of 497.46 g/mol. Its IUPAC name is N-[2-[4-(2-ethoxy-1,1,1,3,3,3-hexafluoropropan-2-yl)phenyl]-4-ethylsulfonylphenyl]acetamide.
| Compound Name | N-[2-[4-(2-ethoxy-1,1,1,3,3,3-hexafluoropropan-2-yl)phenyl]-4-ethylsulfonylphenyl]acetamide |
|---|---|
| PubChem CID | 140890750 |
| Molecular Formula | C21H21F6NO4S |
| Molecular Weight | 497.46 g/mol |
| Exact Mass | 497.11 |
| IUPAC Name | N-[2-[4-(2-ethoxy-1,1,1,3,3,3-hexafluoropropan-2-yl)phenyl]-4-ethylsulfonylphenyl]acetamide |
| SMILES | CCOC(c1ccc(-c2cc(S(=O)(=O)CC)ccc2NC(C)=O)cc1)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C21H21F6NO4S/c1-4-32-19(20(22,23)24,21(25,26)27)15-8-6-14(7-9-15)17-12-16(33(30,31)5-2)10-11-18(17)28-13(3)29/h6-12H,4-5H2,1-3H3,(H,28,29) |
| InChIKey | IVEFXNCTENVLMF-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.46 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |