C23H23ClF4N6OSi — CID 140891188
N-(2-chloro-3-fluoro-4-pyridinyl)-2-[6-(trifluoromethyl)-2-pyridinyl]-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-amine (PubChem CID 140891188) has the molecular formula C23H23ClF4N6OSi and a molecular weight of 539.01 g/mol. Its IUPAC name is N-(2-chloro-3-fluoro-4-pyridinyl)-2-[6-(trifluoromethyl)-2-pyridinyl]-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-amine.
| Compound Name | N-(2-chloro-3-fluoro-4-pyridinyl)-2-[6-(trifluoromethyl)-2-pyridinyl]-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 140891188 |
| Molecular Formula | C23H23ClF4N6OSi |
| Molecular Weight | 539.01 g/mol |
| Exact Mass | 538.13 |
| IUPAC Name | N-(2-chloro-3-fluoro-4-pyridinyl)-2-[6-(trifluoromethyl)-2-pyridinyl]-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-amine |
| SMILES | C[Si](C)(C)CCOCn1ccc2c(Nc3ccnc(Cl)c3F)nc(-c3cccc(C(F)(F)F)n3)nc21 |
| InChI | InChI=1S/C23H23ClF4N6OSi/c1-36(2,3)12-11-35-13-34-10-8-14-20(31-15-7-9-29-19(24)18(15)25)32-21(33-22(14)34)16-5-4-6-17(30-16)23(26,27)28/h4-10H,11-13H2,1-3H3,(H,29,31,32,33) |
| InChIKey | CHDOOEBCIZOMLV-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 77.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.01 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|