C28H35ClF3N7O2Si — CID 140891198
1-[[4-[(2-chloro-5-fluoro-4-pyridinyl)amino]-2-[6-(difluoromethyl)-2-pyridinyl]-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-5-yl]methylamino]-2-methylpropan-2-ol (PubChem CID 140891198) has the molecular formula C28H35ClF3N7O2Si and a molecular weight of 622.17 g/mol. Its IUPAC name is 1-[[4-[(2-chloro-5-fluoro-4-pyridinyl)amino]-2-[6-(difluoromethyl)-2-pyridinyl]-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-5-yl]methylamino]-2-methylpropan-2-ol.
| Compound Name | 1-[[4-[(2-chloro-5-fluoro-4-pyridinyl)amino]-2-[6-(difluoromethyl)-2-pyridinyl]-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-5-yl]methylamino]-2-methylpropan-2-ol |
|---|---|
| PubChem CID | 140891198 |
| Molecular Formula | C28H35ClF3N7O2Si |
| Molecular Weight | 622.17 g/mol |
| Exact Mass | 621.23 |
| IUPAC Name | 1-[[4-[(2-chloro-5-fluoro-4-pyridinyl)amino]-2-[6-(difluoromethyl)-2-pyridinyl]-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-5-yl]methylamino]-2-methylpropan-2-ol |
| SMILES | CC(C)(O)CNCc1cn(COCC[Si](C)(C)C)c2nc(-c3cccc(C(F)F)n3)nc(Nc3cc(Cl)ncc3F)c12 |
| InChI | InChI=1S/C28H35ClF3N7O2Si/c1-28(2,40)15-33-12-17-14-39(16-41-9-10-42(3,4)5)27-23(17)26(36-21-11-22(29)34-13-18(21)30)37-25(38-27)20-8-6-7-19(35-20)24(31)32/h6-8,11,13-14,24,33,40H,9-10,12,15-16H2,1-5H3,(H,34,36,37,38) |
| InChIKey | GOSOKZWHDXMJRF-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 110.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.17 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|