C29H38FN9O2Si — CID 140891213
N-[4-[[2-(6-fluoro-2-pyridinyl)-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]amino]-2-pyridinyl]-2-(4-methylpiperazin-1-yl)acetamide (PubChem CID 140891213) has the molecular formula C29H38FN9O2Si and a molecular weight of 591.77 g/mol. Its IUPAC name is N-[4-[[2-(6-fluoro-2-pyridinyl)-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]amino]-2-pyridinyl]-2-(4-methylpiperazin-1-yl)acetamide.
| Compound Name | N-[4-[[2-(6-fluoro-2-pyridinyl)-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]amino]-2-pyridinyl]-2-(4-methylpiperazin-1-yl)acetamide |
|---|---|
| PubChem CID | 140891213 |
| Molecular Formula | C29H38FN9O2Si |
| Molecular Weight | 591.77 g/mol |
| Exact Mass | 591.29 |
| IUPAC Name | N-[4-[[2-(6-fluoro-2-pyridinyl)-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]amino]-2-pyridinyl]-2-(4-methylpiperazin-1-yl)acetamide |
| SMILES | CN1CCN(CC(=O)Nc2cc(Nc3nc(-c4cccc(F)n4)nc4c3ccn4COCC[Si](C)(C)C)ccn2)CC1 |
| InChI | InChI=1S/C29H38FN9O2Si/c1-37-12-14-38(15-13-37)19-26(40)34-25-18-21(8-10-31-25)32-27-22-9-11-39(20-41-16-17-42(2,3)4)29(22)36-28(35-27)23-6-5-7-24(30)33-23/h5-11,18H,12-17,19-20H2,1-4H3,(H2,31,32,34,35,36,40) |
| InChIKey | PPZBAVHOEMQTNJ-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 113.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.77 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|