C25H27F4N7O2Si — CID 140891214
N-[3-fluoro-4-[[2-[6-(trifluoromethyl)-2-pyridinyl]-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]amino]-2-pyridinyl]acetamide (PubChem CID 140891214) has the molecular formula C25H27F4N7O2Si and a molecular weight of 561.62 g/mol. Its IUPAC name is N-[3-fluoro-4-[[2-[6-(trifluoromethyl)-2-pyridinyl]-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]amino]-2-pyridinyl]acetamide.
| Compound Name | N-[3-fluoro-4-[[2-[6-(trifluoromethyl)-2-pyridinyl]-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]amino]-2-pyridinyl]acetamide |
|---|---|
| PubChem CID | 140891214 |
| Molecular Formula | C25H27F4N7O2Si |
| Molecular Weight | 561.62 g/mol |
| Exact Mass | 561.19 |
| IUPAC Name | N-[3-fluoro-4-[[2-[6-(trifluoromethyl)-2-pyridinyl]-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]amino]-2-pyridinyl]acetamide |
| SMILES | CC(=O)Nc1nccc(Nc2nc(-c3cccc(C(F)(F)F)n3)nc3c2ccn3COCC[Si](C)(C)C)c1F |
| InChI | InChI=1S/C25H27F4N7O2Si/c1-15(37)31-23-20(26)17(8-10-30-23)33-21-16-9-11-36(14-38-12-13-39(2,3)4)24(16)35-22(34-21)18-6-5-7-19(32-18)25(27,28)29/h5-11H,12-14H2,1-4H3,(H2,30,31,33,34,35,37) |
| InChIKey | LEOOWSOXHKXZEP-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 106.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.62 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|