C21H31N5 — CID 140891300
4-[[4-[5-(cyclopentylmethyl)-1-methylpyrazol-4-yl]pyrimidin-2-yl]methyl]cyclohexan-1-amine (PubChem CID 140891300) has the molecular formula C21H31N5 and a molecular weight of 353.51 g/mol. Its IUPAC name is 4-[[4-[5-(cyclopentylmethyl)-1-methylpyrazol-4-yl]pyrimidin-2-yl]methyl]cyclohexan-1-amine.
| Compound Name | 4-[[4-[5-(cyclopentylmethyl)-1-methylpyrazol-4-yl]pyrimidin-2-yl]methyl]cyclohexan-1-amine |
|---|---|
| PubChem CID | 140891300 |
| Molecular Formula | C21H31N5 |
| Molecular Weight | 353.51 g/mol |
| Exact Mass | 353.26 |
| IUPAC Name | 4-[[4-[5-(cyclopentylmethyl)-1-methylpyrazol-4-yl]pyrimidin-2-yl]methyl]cyclohexan-1-amine |
| SMILES | Cn1ncc(-c2ccnc(CC3CCC(N)CC3)n2)c1CC1CCCC1 |
| InChI | InChI=1S/C21H31N5/c1-26-20(12-15-4-2-3-5-15)18(14-24-26)19-10-11-23-21(25-19)13-16-6-8-17(22)9-7-16/h10-11,14-17H,2-9,12-13,22H2,1H3 |
| InChIKey | WXQCXIVBPHBIPL-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.51 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |