About [5-(2,2-dimethylpropanoyloxy)-4-oxopyran-2-yl]methyl (E)-icos-11-enoate
[5-(2,2-dimethylpropanoyloxy)-4-oxopyran-2-yl]methyl (E)-icos-11-enoate (PubChem CID 14089173) has the molecular formula C31H50O6
and a molecular weight of 518.74 g/mol. Its IUPAC name is [5-(2,2-dimethylpropanoyloxy)-4-oxopyran-2-yl]methyl (E)-icos-11-enoate.
Molecular Properties
| Compound Name | [5-(2,2-dimethylpropanoyloxy)-4-oxopyran-2-yl]methyl (E)-icos-11-enoate |
| PubChem CID | 14089173 |
| Molecular Formula | C31H50O6 |
| Molecular Weight | 518.74 g/mol |
| Exact Mass | 518.36 |
| IUPAC Name | [5-(2,2-dimethylpropanoyloxy)-4-oxopyran-2-yl]methyl (E)-icos-11-enoate |
| SMILES | CCCCCCCC/C=C/CCCCCCCCCC(=O)OCc1cc(=O)c(OC(=O)C(C)(C)C)co1 |
| InChI | InChI=1S/C31H50O6/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-29(33)36-24-26-23-27(32)28(25-35-26)37-30(34)31(2,3)4/h12-13,23,25H,5-11,14-22,24H2,1-4H3/b13-12+ |
| InChIKey | ZNRZREAZOIHOAI-OUKQBFOZSA-N |
| XLogP | 8.45 |
| TPSA | 82.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 518.74 |
| LogP ≤ 5 | 8.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [5-(2,2-dimethylpropanoyloxy)-4-oxopyran-2-yl]methyl (E)-icos-11-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-(2,2-dimethylpropanoyloxy)-4-oxopyran-2-yl]methyl (E)-icos-11-enoate?
The IUPAC name of [5-(2,2-dimethylpropanoyloxy)-4-oxopyran-2-yl]methyl (E)-icos-11-enoate (CID 14089173) is [5-(2,2-dimethylpropanoyloxy)-4-oxopyran-2-yl]methyl (E)-icos-11-enoate.
What is the SMILES notation for [5-(2,2-dimethylpropanoyloxy)-4-oxopyran-2-yl]methyl (E)-icos-11-enoate?
The canonical SMILES for [5-(2,2-dimethylpropanoyloxy)-4-oxopyran-2-yl]methyl (E)-icos-11-enoate is CCCCCCCC/C=C/CCCCCCCCCC(=O)OCc1cc(=O)c(OC(=O)C(C)(C)C)co1.
What is the InChIKey of [5-(2,2-dimethylpropanoyloxy)-4-oxopyran-2-yl]methyl (E)-icos-11-enoate?
The InChIKey is ZNRZREAZOIHOAI-OUKQBFOZSA-N. The full InChI is InChI=1S/C31H50O6/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-29(33)36-24-26-23-27(32)28(25-35-26)37-30(34)31(2,3)4/h12-13,23,25H,5-11,14-22,24H2,1-4H3/b13-12+.
What are the key properties of [5-(2,2-dimethylpropanoyloxy)-4-oxopyran-2-yl]methyl (E)-icos-11-enoate?
[5-(2,2-dimethylpropanoyloxy)-4-oxopyran-2-yl]methyl (E)-icos-11-enoate has a molecular weight of 518.74 g/mol, XLogP of 8.45, 20 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(2,2-dimethylpropanoyloxy)-4-oxopyran-2-yl]methyl (E)-icos-11-enoate is sourced from PubChem (CID 14089173), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).