About cobalt(2+);cyclopenta-1,3-diene;ethane
cobalt(2+);cyclopenta-1,3-diene;ethane (PubChem CID 140891740) has the molecular formula C7H10Co
and a molecular weight of 153.09 g/mol. Its IUPAC name is cobalt(2+);cyclopenta-1,3-diene;ethane.
Molecular Properties
| Compound Name | cobalt(2+);cyclopenta-1,3-diene;ethane |
| PubChem CID | 140891740 |
| Molecular Formula | C7H10Co |
| Molecular Weight | 153.09 g/mol |
| Exact Mass | 153.01 |
| IUPAC Name | cobalt(2+);cyclopenta-1,3-diene;ethane |
| SMILES | [CH2-]C.[Co+2].c1cc[cH-]c1 |
| InChI | InChI=1S/C5H5.C2H5.Co/c1-2-4-5-3-1;1-2;/h1-5H;1H2,2H3;/q2*-1;+2 |
| InChIKey | DXNACILIRLIQHU-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.09 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze cobalt(2+);cyclopenta-1,3-diene;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cobalt(2+);cyclopenta-1,3-diene;ethane?
The IUPAC name of cobalt(2+);cyclopenta-1,3-diene;ethane (CID 140891740) is cobalt(2+);cyclopenta-1,3-diene;ethane.
What is the SMILES notation for cobalt(2+);cyclopenta-1,3-diene;ethane?
The canonical SMILES for cobalt(2+);cyclopenta-1,3-diene;ethane is [CH2-]C.[Co+2].c1cc[cH-]c1.
What is the InChIKey of cobalt(2+);cyclopenta-1,3-diene;ethane?
The InChIKey is DXNACILIRLIQHU-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5.C2H5.Co/c1-2-4-5-3-1;1-2;/h1-5H;1H2,2H3;/q2*-1;+2.
What are the key properties of cobalt(2+);cyclopenta-1,3-diene;ethane?
cobalt(2+);cyclopenta-1,3-diene;ethane has a molecular weight of 153.09 g/mol, XLogP of 2.24, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for cobalt(2+);cyclopenta-1,3-diene;ethane is sourced from PubChem (CID 140891740), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).