C34H27NSi — CID 140891943
1,3,4,5,6,7,8-heptadeuterio-N-(4-triphenylsilylphenyl)naphthalen-2-amine (PubChem CID 140891943) has the molecular formula C34H27NSi and a molecular weight of 484.73 g/mol. Its IUPAC name is 1,3,4,5,6,7,8-heptadeuterio-N-(4-triphenylsilylphenyl)naphthalen-2-amine.
| Compound Name | 1,3,4,5,6,7,8-heptadeuterio-N-(4-triphenylsilylphenyl)naphthalen-2-amine |
|---|---|
| PubChem CID | 140891943 |
| Molecular Formula | C34H27NSi |
| Molecular Weight | 484.73 g/mol |
| Exact Mass | 484.24 |
| IUPAC Name | 1,3,4,5,6,7,8-heptadeuterio-N-(4-triphenylsilylphenyl)naphthalen-2-amine |
| SMILES | [2H]c1c([2H])c([2H])c2c([2H])c(Nc3ccc([Si](c4ccccc4)(c4ccccc4)c4ccccc4)cc3)c([2H])c([2H])c2c1[2H] |
| InChI | InChI=1S/C34H27NSi/c1-4-14-31(15-5-1)36(32-16-6-2-7-17-32,33-18-8-3-9-19-33)34-24-22-29(23-25-34)35-30-21-20-27-12-10-11-13-28(27)26-30/h1-26,35H/i10D,11D,12D,13D,20D,21D,26D |
| InChIKey | HLXURGOPMZTEOZ-GPQHFOQHSA-N |
| XLogP | 5.96 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.73 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|