C46H31NO — CID 140891985
N-(4-dibenzofuran-2-ylphenyl)-N-[4-(2,3,4,5,6,7,8-heptadeuterionaphthalen-1-yl)phenyl]-4-phenylaniline (PubChem CID 140891985) has the molecular formula C46H31NO and a molecular weight of 620.80 g/mol. Its IUPAC name is N-(4-dibenzofuran-2-ylphenyl)-N-[4-(2,3,4,5,6,7,8-heptadeuterionaphthalen-1-yl)phenyl]-4-phenylaniline.
| Compound Name | N-(4-dibenzofuran-2-ylphenyl)-N-[4-(2,3,4,5,6,7,8-heptadeuterionaphthalen-1-yl)phenyl]-4-phenylaniline |
|---|---|
| PubChem CID | 140891985 |
| Molecular Formula | C46H31NO |
| Molecular Weight | 620.80 g/mol |
| Exact Mass | 620.28 |
| IUPAC Name | N-(4-dibenzofuran-2-ylphenyl)-N-[4-(2,3,4,5,6,7,8-heptadeuterionaphthalen-1-yl)phenyl]-4-phenylaniline |
| SMILES | [2H]c1c([2H])c([2H])c2c(-c3ccc(N(c4ccc(-c5ccccc5)cc4)c4ccc(-c5ccc6oc7ccccc7c6c5)cc4)cc3)c([2H])c([2H])c([2H])c2c1[2H] |
| InChI | InChI=1S/C46H31NO/c1-2-9-32(10-3-1)33-17-24-38(25-18-33)47(40-28-21-36(22-29-40)42-15-8-12-35-11-4-5-13-41(35)42)39-26-19-34(20-27-39)37-23-30-46-44(31-37)43-14-6-7-16-45(43)48-46/h1-31H/i4D,5D,8D,11D,12D,13D,15D |
| InChIKey | GIDQAROPSPHHMP-ODJIJJKBSA-N |
| XLogP | 13.21 |
| TPSA | 16.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.80 |
| LogP ≤ 5 | 13.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |