About (5S)-4,5-dimethyltricyclo[3.2.1.11,4]nonane
(5S)-4,5-dimethyltricyclo[3.2.1.11,4]nonane (PubChem CID 140892136) has the molecular formula C11H18
and a molecular weight of 150.27 g/mol. Its IUPAC name is (5S)-4,5-dimethyltricyclo[3.2.1.11,4]nonane.
Molecular Properties
| Compound Name | (5S)-4,5-dimethyltricyclo[3.2.1.11,4]nonane |
| PubChem CID | 140892136 |
| Molecular Formula | C11H18 |
| Molecular Weight | 150.27 g/mol |
| Exact Mass | 150.14 |
| IUPAC Name | (5S)-4,5-dimethyltricyclo[3.2.1.11,4]nonane |
| SMILES | CC12CCC3(CC[C@@]1(C)C3)C2 |
| InChI | InChI=1S/C11H18/c1-9-3-5-11(7-9)6-4-10(9,2)8-11/h3-8H2,1-2H3/t9-,10?,11?/m0/s1 |
| InChIKey | XYJITPOAHGYSBQ-WHXUTIOJSA-N |
| XLogP | 3.37 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.27 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze (5S)-4,5-dimethyltricyclo[3.2.1.11,4]nonane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5S)-4,5-dimethyltricyclo[3.2.1.11,4]nonane?
The IUPAC name of (5S)-4,5-dimethyltricyclo[3.2.1.11,4]nonane (CID 140892136) is (5S)-4,5-dimethyltricyclo[3.2.1.11,4]nonane.
What is the SMILES notation for (5S)-4,5-dimethyltricyclo[3.2.1.11,4]nonane?
The canonical SMILES for (5S)-4,5-dimethyltricyclo[3.2.1.11,4]nonane is CC12CCC3(CC[C@@]1(C)C3)C2.
What is the InChIKey of (5S)-4,5-dimethyltricyclo[3.2.1.11,4]nonane?
The InChIKey is XYJITPOAHGYSBQ-WHXUTIOJSA-N. The full InChI is InChI=1S/C11H18/c1-9-3-5-11(7-9)6-4-10(9,2)8-11/h3-8H2,1-2H3/t9-,10?,11?/m0/s1.
What are the key properties of (5S)-4,5-dimethyltricyclo[3.2.1.11,4]nonane?
(5S)-4,5-dimethyltricyclo[3.2.1.11,4]nonane has a molecular weight of 150.27 g/mol, XLogP of 3.37, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (5S)-4,5-dimethyltricyclo[3.2.1.11,4]nonane is sourced from PubChem (CID 140892136), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).