About nonyl 4-(2-cyclohexyloxyethoxy)cyclohexane-1-carboxylate
nonyl 4-(2-cyclohexyloxyethoxy)cyclohexane-1-carboxylate (PubChem CID 140892346) has the molecular formula C24H44O4
and a molecular weight of 396.61 g/mol. Its IUPAC name is nonyl 4-(2-cyclohexyloxyethoxy)cyclohexane-1-carboxylate.
Molecular Properties
| Compound Name | nonyl 4-(2-cyclohexyloxyethoxy)cyclohexane-1-carboxylate |
| PubChem CID | 140892346 |
| Molecular Formula | C24H44O4 |
| Molecular Weight | 396.61 g/mol |
| Exact Mass | 396.32 |
| IUPAC Name | nonyl 4-(2-cyclohexyloxyethoxy)cyclohexane-1-carboxylate |
| SMILES | CCCCCCCCCOC(=O)C1CCC(OCCOC2CCCCC2)CC1 |
| InChI | InChI=1S/C24H44O4/c1-2-3-4-5-6-7-11-18-28-24(25)21-14-16-23(17-15-21)27-20-19-26-22-12-9-8-10-13-22/h21-23H,2-20H2,1H3 |
| InChIKey | FCNRGEAXLVOCKG-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 396.61 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze nonyl 4-(2-cyclohexyloxyethoxy)cyclohexane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of nonyl 4-(2-cyclohexyloxyethoxy)cyclohexane-1-carboxylate?
The IUPAC name of nonyl 4-(2-cyclohexyloxyethoxy)cyclohexane-1-carboxylate (CID 140892346) is nonyl 4-(2-cyclohexyloxyethoxy)cyclohexane-1-carboxylate.
What is the SMILES notation for nonyl 4-(2-cyclohexyloxyethoxy)cyclohexane-1-carboxylate?
The canonical SMILES for nonyl 4-(2-cyclohexyloxyethoxy)cyclohexane-1-carboxylate is CCCCCCCCCOC(=O)C1CCC(OCCOC2CCCCC2)CC1.
What is the InChIKey of nonyl 4-(2-cyclohexyloxyethoxy)cyclohexane-1-carboxylate?
The InChIKey is FCNRGEAXLVOCKG-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H44O4/c1-2-3-4-5-6-7-11-18-28-24(25)21-14-16-23(17-15-21)27-20-19-26-22-12-9-8-10-13-22/h21-23H,2-20H2,1H3.
What are the key properties of nonyl 4-(2-cyclohexyloxyethoxy)cyclohexane-1-carboxylate?
nonyl 4-(2-cyclohexyloxyethoxy)cyclohexane-1-carboxylate has a molecular weight of 396.61 g/mol, XLogP of 6.20, 14 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for nonyl 4-(2-cyclohexyloxyethoxy)cyclohexane-1-carboxylate is sourced from PubChem (CID 140892346), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).