About CID 140892716
CID 140892716 (PubChem CID 140892716) has the molecular formula C11H16O3Si
and a molecular weight of 224.33 g/mol.
Molecular Properties
| Compound Name | CID 140892716 |
| PubChem CID | 140892716 |
| Molecular Formula | C11H16O3Si |
| Molecular Weight | 224.33 g/mol |
| Exact Mass | 224.09 |
| IUPAC Name | — |
| SMILES | C[Si]OCCCOCc1ccccc1O |
| InChI | InChI=1S/C11H16O3Si/c1-15-14-8-4-7-13-9-10-5-2-3-6-11(10)12/h2-3,5-6,12H,4,7-9H2,1H3 |
| InChIKey | YKCXZXQTZDDVRY-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.33 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 140892716 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 140892716?
The IUPAC name of CID 140892716 (CID 140892716) is not available.
What is the SMILES notation for CID 140892716?
The canonical SMILES for CID 140892716 is C[Si]OCCCOCc1ccccc1O.
What is the InChIKey of CID 140892716?
The InChIKey is YKCXZXQTZDDVRY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16O3Si/c1-15-14-8-4-7-13-9-10-5-2-3-6-11(10)12/h2-3,5-6,12H,4,7-9H2,1H3.
What are the key properties of CID 140892716?
CID 140892716 has a molecular weight of 224.33 g/mol, XLogP of 1.98, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 140892716 is sourced from PubChem (CID 140892716), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).