C8H23NO3Si3 — CID 140893211
1-(4-ethyl-2,4,6,6-tetramethyl-1,3,5,2,4,6-trioxatrisilinan-2-yl)-N-methylmethanamine (PubChem CID 140893211) has the molecular formula C8H23NO3Si3 and a molecular weight of 265.53 g/mol. Its IUPAC name is 1-(4-ethyl-2,4,6,6-tetramethyl-1,3,5,2,4,6-trioxatrisilinan-2-yl)-N-methylmethanamine.
| Compound Name | 1-(4-ethyl-2,4,6,6-tetramethyl-1,3,5,2,4,6-trioxatrisilinan-2-yl)-N-methylmethanamine |
|---|---|
| PubChem CID | 140893211 |
| Molecular Formula | C8H23NO3Si3 |
| Molecular Weight | 265.53 g/mol |
| Exact Mass | 265.10 |
| IUPAC Name | 1-(4-ethyl-2,4,6,6-tetramethyl-1,3,5,2,4,6-trioxatrisilinan-2-yl)-N-methylmethanamine |
| SMILES | CC[Si]1(C)O[Si](C)(C)O[Si](C)(CNC)O1 |
| InChI | InChI=1S/C8H23NO3Si3/c1-7-14(5)10-13(3,4)11-15(6,12-14)8-9-2/h9H,7-8H2,1-6H3 |
| InChIKey | RRZUGZNIGXBJTC-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.53 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|