C24H17ClF2N4O — CID 140893361
5-[3-chloro-7-fluoro-4-[[(1R)-1-(2-fluoro-5-isocyanophenyl)ethyl]amino]-2-methylquinolin-6-yl]-1H-pyridin-2-one (PubChem CID 140893361) has the molecular formula C24H17ClF2N4O and a molecular weight of 450.88 g/mol. Its IUPAC name is 5-[3-chloro-7-fluoro-4-[[(1R)-1-(2-fluoro-5-isocyanophenyl)ethyl]amino]-2-methylquinolin-6-yl]-1H-pyridin-2-one.
| Compound Name | 5-[3-chloro-7-fluoro-4-[[(1R)-1-(2-fluoro-5-isocyanophenyl)ethyl]amino]-2-methylquinolin-6-yl]-1H-pyridin-2-one |
|---|---|
| PubChem CID | 140893361 |
| Molecular Formula | C24H17ClF2N4O |
| Molecular Weight | 450.88 g/mol |
| Exact Mass | 450.11 |
| IUPAC Name | 5-[3-chloro-7-fluoro-4-[[(1R)-1-(2-fluoro-5-isocyanophenyl)ethyl]amino]-2-methylquinolin-6-yl]-1H-pyridin-2-one |
| SMILES | [C-]#[N+]c1ccc(F)c([C@@H](C)Nc2c(Cl)c(C)nc3cc(F)c(-c4ccc(=O)[nH]c4)cc23)c1 |
| InChI | InChI=1S/C24H17ClF2N4O/c1-12(16-8-15(28-3)5-6-19(16)26)31-24-18-9-17(14-4-7-22(32)29-11-14)20(27)10-21(18)30-13(2)23(24)25/h4-12H,1-2H3,(H,29,32)(H,30,31)/t12-/m1/s1 |
| InChIKey | QWCUHFCRLNRWJC-GFCCVEGCSA-N |
| XLogP | 6.55 |
| TPSA | 62.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.88 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|