C23H38N2O2S — CID 140893568
3-(4-hydroxy-1-propylpiperidin-4-yl)-5-(3-methylsulfanylphenyl)-1-propylpiperidin-4-ol (PubChem CID 140893568) has the molecular formula C23H38N2O2S and a molecular weight of 406.64 g/mol. Its IUPAC name is 3-(4-hydroxy-1-propylpiperidin-4-yl)-5-(3-methylsulfanylphenyl)-1-propylpiperidin-4-ol.
| Compound Name | 3-(4-hydroxy-1-propylpiperidin-4-yl)-5-(3-methylsulfanylphenyl)-1-propylpiperidin-4-ol |
|---|---|
| PubChem CID | 140893568 |
| Molecular Formula | C23H38N2O2S |
| Molecular Weight | 406.64 g/mol |
| Exact Mass | 406.27 |
| IUPAC Name | 3-(4-hydroxy-1-propylpiperidin-4-yl)-5-(3-methylsulfanylphenyl)-1-propylpiperidin-4-ol |
| SMILES | CCCN1CCC(O)(C2CN(CCC)CC(c3cccc(SC)c3)C2O)CC1 |
| InChI | InChI=1S/C23H38N2O2S/c1-4-11-24-13-9-23(27,10-14-24)21-17-25(12-5-2)16-20(22(21)26)18-7-6-8-19(15-18)28-3/h6-8,15,20-22,26-27H,4-5,9-14,16-17H2,1-3H3 |
| InChIKey | GZGSDYATSGXPBM-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 46.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.64 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |