About [2-chloro-4-(2,4,4-trimethylpentan-2-yl)phenyl] trifluoromethanesulfonate
[2-chloro-4-(2,4,4-trimethylpentan-2-yl)phenyl] trifluoromethanesulfonate (PubChem CID 140893878) has the molecular formula C15H20ClF3O3S
and a molecular weight of 372.84 g/mol. Its IUPAC name is [2-chloro-4-(2,4,4-trimethylpentan-2-yl)phenyl] trifluoromethanesulfonate.
Molecular Properties
| Compound Name | [2-chloro-4-(2,4,4-trimethylpentan-2-yl)phenyl] trifluoromethanesulfonate |
| PubChem CID | 140893878 |
| Molecular Formula | C15H20ClF3O3S |
| Molecular Weight | 372.84 g/mol |
| Exact Mass | 372.08 |
| IUPAC Name | [2-chloro-4-(2,4,4-trimethylpentan-2-yl)phenyl] trifluoromethanesulfonate |
| SMILES | CC(C)(C)CC(C)(C)c1ccc(OS(=O)(=O)C(F)(F)F)c(Cl)c1 |
| InChI | InChI=1S/C15H20ClF3O3S/c1-13(2,3)9-14(4,5)10-6-7-12(11(16)8-10)22-23(20,21)15(17,18)19/h6-8H,9H2,1-5H3 |
| InChIKey | RQJSBHXPIDQRAL-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 372.84 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze [2-chloro-4-(2,4,4-trimethylpentan-2-yl)phenyl] trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-chloro-4-(2,4,4-trimethylpentan-2-yl)phenyl] trifluoromethanesulfonate?
The IUPAC name of [2-chloro-4-(2,4,4-trimethylpentan-2-yl)phenyl] trifluoromethanesulfonate (CID 140893878) is [2-chloro-4-(2,4,4-trimethylpentan-2-yl)phenyl] trifluoromethanesulfonate.
What is the SMILES notation for [2-chloro-4-(2,4,4-trimethylpentan-2-yl)phenyl] trifluoromethanesulfonate?
The canonical SMILES for [2-chloro-4-(2,4,4-trimethylpentan-2-yl)phenyl] trifluoromethanesulfonate is CC(C)(C)CC(C)(C)c1ccc(OS(=O)(=O)C(F)(F)F)c(Cl)c1.
What is the InChIKey of [2-chloro-4-(2,4,4-trimethylpentan-2-yl)phenyl] trifluoromethanesulfonate?
The InChIKey is RQJSBHXPIDQRAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20ClF3O3S/c1-13(2,3)9-14(4,5)10-6-7-12(11(16)8-10)22-23(20,21)15(17,18)19/h6-8H,9H2,1-5H3.
What are the key properties of [2-chloro-4-(2,4,4-trimethylpentan-2-yl)phenyl] trifluoromethanesulfonate?
[2-chloro-4-(2,4,4-trimethylpentan-2-yl)phenyl] trifluoromethanesulfonate has a molecular weight of 372.84 g/mol, XLogP of 5.28, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [2-chloro-4-(2,4,4-trimethylpentan-2-yl)phenyl] trifluoromethanesulfonate is sourced from PubChem (CID 140893878), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).