C27H25F3N4O5S — CID 140894328
1,1-dioxo-N-(3-phenylphenyl)-N-[[4-[[(2,2,2-trifluoroacetyl)amino]carbamoyl]phenyl]methyl]-1,4-thiazinane-4-carboxamide (PubChem CID 140894328) has the molecular formula C27H25F3N4O5S and a molecular weight of 574.58 g/mol. Its IUPAC name is 1,1-dioxo-N-(3-phenylphenyl)-N-[[4-[[(2,2,2-trifluoroacetyl)amino]carbamoyl]phenyl]methyl]-1,4-thiazinane-4-carboxamide.
| Compound Name | 1,1-dioxo-N-(3-phenylphenyl)-N-[[4-[[(2,2,2-trifluoroacetyl)amino]carbamoyl]phenyl]methyl]-1,4-thiazinane-4-carboxamide |
|---|---|
| PubChem CID | 140894328 |
| Molecular Formula | C27H25F3N4O5S |
| Molecular Weight | 574.58 g/mol |
| Exact Mass | 574.15 |
| IUPAC Name | 1,1-dioxo-N-(3-phenylphenyl)-N-[[4-[[(2,2,2-trifluoroacetyl)amino]carbamoyl]phenyl]methyl]-1,4-thiazinane-4-carboxamide |
| SMILES | O=C(NNC(=O)C(F)(F)F)c1ccc(CN(C(=O)N2CCS(=O)(=O)CC2)c2cccc(-c3ccccc3)c2)cc1 |
| InChI | InChI=1S/C27H25F3N4O5S/c28-27(29,30)25(36)32-31-24(35)21-11-9-19(10-12-21)18-34(26(37)33-13-15-40(38,39)16-14-33)23-8-4-7-22(17-23)20-5-2-1-3-6-20/h1-12,17H,13-16,18H2,(H,31,35)(H,32,36) |
| InChIKey | ZOLMDOXRRKGVPJ-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 115.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.58 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|