C26H32F4N6O4S — CID 140894407
N-[[2-fluoro-4-(hydrazinecarbonyl)phenyl]methyl]-1,1-dioxo-N-[4-[[4-(2,2,2-trifluoroethyl)piperazin-1-yl]methyl]phenyl]-1,4-thiazinane-4-carboxamide (PubChem CID 140894407) has the molecular formula C26H32F4N6O4S and a molecular weight of 600.64 g/mol. Its IUPAC name is N-[[2-fluoro-4-(hydrazinecarbonyl)phenyl]methyl]-1,1-dioxo-N-[4-[[4-(2,2,2-trifluoroethyl)piperazin-1-yl]methyl]phenyl]-1,4-thiazinane-4-carboxamide.
| Compound Name | N-[[2-fluoro-4-(hydrazinecarbonyl)phenyl]methyl]-1,1-dioxo-N-[4-[[4-(2,2,2-trifluoroethyl)piperazin-1-yl]methyl]phenyl]-1,4-thiazinane-4-carboxamide |
|---|---|
| PubChem CID | 140894407 |
| Molecular Formula | C26H32F4N6O4S |
| Molecular Weight | 600.64 g/mol |
| Exact Mass | 600.21 |
| IUPAC Name | N-[[2-fluoro-4-(hydrazinecarbonyl)phenyl]methyl]-1,1-dioxo-N-[4-[[4-(2,2,2-trifluoroethyl)piperazin-1-yl]methyl]phenyl]-1,4-thiazinane-4-carboxamide |
| SMILES | NNC(=O)c1ccc(CN(C(=O)N2CCS(=O)(=O)CC2)c2ccc(CN3CCN(CC(F)(F)F)CC3)cc2)c(F)c1 |
| InChI | InChI=1S/C26H32F4N6O4S/c27-23-15-20(24(37)32-31)3-4-21(23)17-36(25(38)35-11-13-41(39,40)14-12-35)22-5-1-19(2-6-22)16-33-7-9-34(10-8-33)18-26(28,29)30/h1-6,15H,7-14,16-18,31H2,(H,32,37) |
| InChIKey | DJAGRXFWAGOTEC-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 119.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.64 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|