C11H11F2NO2 — CID 140895641
6a-(2,3-difluorophenyl)-3,3a,4,6-tetrahydro-1H-furo[3,4-c][1,2]oxazole (PubChem CID 140895641) has the molecular formula C11H11F2NO2 and a molecular weight of 227.21 g/mol. Its IUPAC name is 6a-(2,3-difluorophenyl)-3,3a,4,6-tetrahydro-1H-furo[3,4-c][1,2]oxazole.
| Compound Name | 6a-(2,3-difluorophenyl)-3,3a,4,6-tetrahydro-1H-furo[3,4-c][1,2]oxazole |
|---|---|
| PubChem CID | 140895641 |
| Molecular Formula | C11H11F2NO2 |
| Molecular Weight | 227.21 g/mol |
| Exact Mass | 227.08 |
| IUPAC Name | 6a-(2,3-difluorophenyl)-3,3a,4,6-tetrahydro-1H-furo[3,4-c][1,2]oxazole |
| SMILES | Fc1cccc(C23COCC2CON3)c1F |
| InChI | InChI=1S/C11H11F2NO2/c12-9-3-1-2-8(10(9)13)11-6-15-4-7(11)5-16-14-11/h1-3,7,14H,4-6H2 |
| InChIKey | QYPIFSWIEBYHOP-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.21 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |